C13H13ClIN5 — CID 80686278
2-(chloromethyl)-5-iodo-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole (PubChem CID 80686278) has the molecular formula C13H13ClIN5 and a molecular weight of 401.64 g/mol. Its IUPAC name is 2-(chloromethyl)-5-iodo-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole.
| Compound Name | 2-(chloromethyl)-5-iodo-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 80686278 |
| Molecular Formula | C13H13ClIN5 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 2-(chloromethyl)-5-iodo-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole |
| SMILES | Cn1cnc(CCn2c(CCl)nc3cc(I)ccc32)n1 |
| InChI | InChI=1S/C13H13ClIN5/c1-19-8-16-12(18-19)4-5-20-11-3-2-9(15)6-10(11)17-13(20)7-14/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | YPHUQHZPLVYXOX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|