C13H13ClFN5 — CID 80686060
2-(chloromethyl)-4-fluoro-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole (PubChem CID 80686060) has the molecular formula C13H13ClFN5 and a molecular weight of 293.73 g/mol. Its IUPAC name is 2-(chloromethyl)-4-fluoro-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole.
| Compound Name | 2-(chloromethyl)-4-fluoro-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 80686060 |
| Molecular Formula | C13H13ClFN5 |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-(chloromethyl)-4-fluoro-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole |
| SMILES | Cn1cnc(CCn2c(CCl)nc3c(F)cccc32)n1 |
| InChI | InChI=1S/C13H13ClFN5/c1-19-8-16-11(18-19)5-6-20-10-4-2-3-9(15)13(10)17-12(20)7-14/h2-4,8H,5-7H2,1H3 |
| InChIKey | KQNFDQRTGQEFDE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|