C14H15Cl2N5 — CID 104838504
4-chloro-2-(1-chloroethyl)-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole (PubChem CID 104838504) has the molecular formula C14H15Cl2N5 and a molecular weight of 324.22 g/mol. Its IUPAC name is 4-chloro-2-(1-chloroethyl)-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole.
| Compound Name | 4-chloro-2-(1-chloroethyl)-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 104838504 |
| Molecular Formula | C14H15Cl2N5 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-chloro-2-(1-chloroethyl)-1-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole |
| SMILES | CC(Cl)c1nc2c(Cl)cccc2n1CCc1ncn(C)n1 |
| InChI | InChI=1S/C14H15Cl2N5/c1-9(15)14-18-13-10(16)4-3-5-11(13)21(14)7-6-12-17-8-20(2)19-12/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | BKBUIGDIDWEHJZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|