C15H20BrClN2 — CID 115326558
5-bromo-2-(chloromethyl)-1-(5-methylhexyl)benzimidazole (PubChem CID 115326558) has the molecular formula C15H20BrClN2 and a molecular weight of 343.70 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-1-(5-methylhexyl)benzimidazole.
| Compound Name | 5-bromo-2-(chloromethyl)-1-(5-methylhexyl)benzimidazole |
|---|---|
| PubChem CID | 115326558 |
| Molecular Formula | C15H20BrClN2 |
| Molecular Weight | 343.70 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-1-(5-methylhexyl)benzimidazole |
| SMILES | CC(C)CCCCn1c(CCl)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H20BrClN2/c1-11(2)5-3-4-8-19-14-7-6-12(16)9-13(14)18-15(19)10-17/h6-7,9,11H,3-5,8,10H2,1-2H3 |
| InChIKey | KUYGPIMEYTYFQW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|