C14H19BrClN3 — CID 43660318
2-[5-bromo-2-(chloromethyl)benzimidazol-1-yl]-N,N-diethylethanamine (PubChem CID 43660318) has the molecular formula C14H19BrClN3 and a molecular weight of 344.68 g/mol. Its IUPAC name is 2-[5-bromo-2-(chloromethyl)benzimidazol-1-yl]-N,N-diethylethanamine.
| Compound Name | 2-[5-bromo-2-(chloromethyl)benzimidazol-1-yl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 43660318 |
| Molecular Formula | C14H19BrClN3 |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-[5-bromo-2-(chloromethyl)benzimidazol-1-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1c(CCl)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H19BrClN3/c1-3-18(4-2)7-8-19-13-6-5-11(15)9-12(13)17-14(19)10-16/h5-6,9H,3-4,7-8,10H2,1-2H3 |
| InChIKey | NEFOAQHEXGWGOY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|