C14H18Cl2FN3 — CID 66112168
2-[5-chloro-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]-N,N-diethylethanamine (PubChem CID 66112168) has the molecular formula C14H18Cl2FN3 and a molecular weight of 318.22 g/mol. Its IUPAC name is 2-[5-chloro-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]-N,N-diethylethanamine.
| Compound Name | 2-[5-chloro-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 66112168 |
| Molecular Formula | C14H18Cl2FN3 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-[5-chloro-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1c(CCl)nc2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C14H18Cl2FN3/c1-3-19(4-2)5-6-20-13-8-11(17)10(16)7-12(13)18-14(20)9-15/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | GIPHPTQVGZZTKT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|