C11H11Cl2FN2O2S — CID 114089618
6-chloro-2-(chloromethyl)-5-fluoro-1-(2-methylsulfonylethyl)benzimidazole (PubChem CID 114089618) has the molecular formula C11H11Cl2FN2O2S and a molecular weight of 325.19 g/mol. Its IUPAC name is 6-chloro-2-(chloromethyl)-5-fluoro-1-(2-methylsulfonylethyl)benzimidazole.
| Compound Name | 6-chloro-2-(chloromethyl)-5-fluoro-1-(2-methylsulfonylethyl)benzimidazole |
|---|---|
| PubChem CID | 114089618 |
| Molecular Formula | C11H11Cl2FN2O2S |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 6-chloro-2-(chloromethyl)-5-fluoro-1-(2-methylsulfonylethyl)benzimidazole |
| SMILES | CS(=O)(=O)CCn1c(CCl)nc2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C11H11Cl2FN2O2S/c1-19(17,18)3-2-16-10-4-7(13)8(14)5-9(10)15-11(16)6-12/h4-5H,2-3,6H2,1H3 |
| InChIKey | NSAVOFXZCDVOHL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|