C13H15ClFIN2O2S — CID 66095904
2-(2-chloroethyl)-6-fluoro-5-iodo-1-(3-methylsulfonylpropyl)benzimidazole (PubChem CID 66095904) has the molecular formula C13H15ClFIN2O2S and a molecular weight of 444.70 g/mol. Its IUPAC name is 2-(2-chloroethyl)-6-fluoro-5-iodo-1-(3-methylsulfonylpropyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-6-fluoro-5-iodo-1-(3-methylsulfonylpropyl)benzimidazole |
|---|---|
| PubChem CID | 66095904 |
| Molecular Formula | C13H15ClFIN2O2S |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | 2-(2-chloroethyl)-6-fluoro-5-iodo-1-(3-methylsulfonylpropyl)benzimidazole |
| SMILES | CS(=O)(=O)CCCn1c(CCCl)nc2cc(I)c(F)cc21 |
| InChI | InChI=1S/C13H15ClFIN2O2S/c1-21(19,20)6-2-5-18-12-7-9(15)10(16)8-11(12)17-13(18)3-4-14/h7-8H,2-6H2,1H3 |
| InChIKey | FFUJYWLBFAFKSU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|