C13H15ClFIN2O — CID 102699532
2-(2-chloroethyl)-6-fluoro-5-iodo-1-(2-methoxypropyl)benzimidazole (PubChem CID 102699532) has the molecular formula C13H15ClFIN2O and a molecular weight of 396.63 g/mol. Its IUPAC name is 2-(2-chloroethyl)-6-fluoro-5-iodo-1-(2-methoxypropyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-6-fluoro-5-iodo-1-(2-methoxypropyl)benzimidazole |
|---|---|
| PubChem CID | 102699532 |
| Molecular Formula | C13H15ClFIN2O |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-(2-chloroethyl)-6-fluoro-5-iodo-1-(2-methoxypropyl)benzimidazole |
| SMILES | COC(C)Cn1c(CCCl)nc2cc(I)c(F)cc21 |
| InChI | InChI=1S/C13H15ClFIN2O/c1-8(19-2)7-18-12-5-9(15)10(16)6-11(12)17-13(18)3-4-14/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | WNSDUNYRNPJCKG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|