C15H20ClFIN3 — CID 106037367
3-[2-(chloromethyl)-6-fluoro-5-iodobenzimidazol-1-yl]-N-methyl-N-propan-2-ylpropan-1-amine (PubChem CID 106037367) has the molecular formula C15H20ClFIN3 and a molecular weight of 423.70 g/mol. Its IUPAC name is 3-[2-(chloromethyl)-6-fluoro-5-iodobenzimidazol-1-yl]-N-methyl-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[2-(chloromethyl)-6-fluoro-5-iodobenzimidazol-1-yl]-N-methyl-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 106037367 |
| Molecular Formula | C15H20ClFIN3 |
| Molecular Weight | 423.70 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 3-[2-(chloromethyl)-6-fluoro-5-iodobenzimidazol-1-yl]-N-methyl-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)N(C)CCCn1c(CCl)nc2cc(I)c(F)cc21 |
| InChI | InChI=1S/C15H20ClFIN3/c1-10(2)20(3)5-4-6-21-14-7-11(17)12(18)8-13(14)19-15(21)9-16/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | NPXRMVAQXZYSBY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|