C14H13ClFIN4 — CID 115991015
2-(chloromethyl)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-6-fluoro-5-iodobenzimidazole (PubChem CID 115991015) has the molecular formula C14H13ClFIN4 and a molecular weight of 418.64 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-6-fluoro-5-iodobenzimidazole.
| Compound Name | 2-(chloromethyl)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-6-fluoro-5-iodobenzimidazole |
|---|---|
| PubChem CID | 115991015 |
| Molecular Formula | C14H13ClFIN4 |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 2-(chloromethyl)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-6-fluoro-5-iodobenzimidazole |
| SMILES | Cc1nn(C)cc1Cn1c(CCl)nc2cc(I)c(F)cc21 |
| InChI | InChI=1S/C14H13ClFIN4/c1-8-9(6-20(2)19-8)7-21-13-3-10(16)11(17)4-12(13)18-14(21)5-15/h3-4,6H,5,7H2,1-2H3 |
| InChIKey | GRSFTEHCBRYWGT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|