C15H19ClFIN2O — CID 66095086
2-(chloromethyl)-6-fluoro-5-iodo-1-[2-(3-methylbutoxy)ethyl]benzimidazole (PubChem CID 66095086) has the molecular formula C15H19ClFIN2O and a molecular weight of 424.69 g/mol. Its IUPAC name is 2-(chloromethyl)-6-fluoro-5-iodo-1-[2-(3-methylbutoxy)ethyl]benzimidazole.
| Compound Name | 2-(chloromethyl)-6-fluoro-5-iodo-1-[2-(3-methylbutoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 66095086 |
| Molecular Formula | C15H19ClFIN2O |
| Molecular Weight | 424.69 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 2-(chloromethyl)-6-fluoro-5-iodo-1-[2-(3-methylbutoxy)ethyl]benzimidazole |
| SMILES | CC(C)CCOCCn1c(CCl)nc2cc(I)c(F)cc21 |
| InChI | InChI=1S/C15H19ClFIN2O/c1-10(2)3-5-21-6-4-20-14-7-11(17)12(18)8-13(14)19-15(20)9-16/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | CJEVBCPTELFOFX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|