C14H17ClFIN2 — CID 66094669
2-(chloromethyl)-6-fluoro-5-iodo-1-(2-methylpentan-3-yl)benzimidazole (PubChem CID 66094669) has the molecular formula C14H17ClFIN2 and a molecular weight of 394.66 g/mol. Its IUPAC name is 2-(chloromethyl)-6-fluoro-5-iodo-1-(2-methylpentan-3-yl)benzimidazole.
| Compound Name | 2-(chloromethyl)-6-fluoro-5-iodo-1-(2-methylpentan-3-yl)benzimidazole |
|---|---|
| PubChem CID | 66094669 |
| Molecular Formula | C14H17ClFIN2 |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-(chloromethyl)-6-fluoro-5-iodo-1-(2-methylpentan-3-yl)benzimidazole |
| SMILES | CCC(C(C)C)n1c(CCl)nc2cc(I)c(F)cc21 |
| InChI | InChI=1S/C14H17ClFIN2/c1-4-12(8(2)3)19-13-5-9(16)10(17)6-11(13)18-14(19)7-15/h5-6,8,12H,4,7H2,1-3H3 |
| InChIKey | ADDIFFXDGRCUNW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|