C14H18BrClFN3 — CID 66088080
4-[5-bromo-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]-N,N-dimethylbutan-1-amine (PubChem CID 66088080) has the molecular formula C14H18BrClFN3 and a molecular weight of 362.67 g/mol. Its IUPAC name is 4-[5-bromo-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[5-bromo-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 66088080 |
| Molecular Formula | C14H18BrClFN3 |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 4-[5-bromo-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCn1c(CCl)nc2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C14H18BrClFN3/c1-19(2)5-3-4-6-20-13-8-11(17)10(15)7-12(13)18-14(20)9-16/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | PBZGTLWAXRAAGH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|