C15H19BrClFN2 — CID 66088103
5-bromo-2-(chloromethyl)-1-(3-ethylpentan-3-yl)-6-fluorobenzimidazole (PubChem CID 66088103) has the molecular formula C15H19BrClFN2 and a molecular weight of 361.69 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-1-(3-ethylpentan-3-yl)-6-fluorobenzimidazole.
| Compound Name | 5-bromo-2-(chloromethyl)-1-(3-ethylpentan-3-yl)-6-fluorobenzimidazole |
|---|---|
| PubChem CID | 66088103 |
| Molecular Formula | C15H19BrClFN2 |
| Molecular Weight | 361.69 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-1-(3-ethylpentan-3-yl)-6-fluorobenzimidazole |
| SMILES | CCC(CC)(CC)n1c(CCl)nc2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C15H19BrClFN2/c1-4-15(5-2,6-3)20-13-8-11(18)10(16)7-12(13)19-14(20)9-17/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | MVWCYKZKLDEBTC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|