C15H17BrClFN2 — CID 66087529
5-bromo-2-(chloromethyl)-6-fluoro-1-[(1-methylcyclopentyl)methyl]benzimidazole (PubChem CID 66087529) has the molecular formula C15H17BrClFN2 and a molecular weight of 359.67 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-6-fluoro-1-[(1-methylcyclopentyl)methyl]benzimidazole.
| Compound Name | 5-bromo-2-(chloromethyl)-6-fluoro-1-[(1-methylcyclopentyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 66087529 |
| Molecular Formula | C15H17BrClFN2 |
| Molecular Weight | 359.67 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-6-fluoro-1-[(1-methylcyclopentyl)methyl]benzimidazole |
| SMILES | CC1(Cn2c(CCl)nc3cc(Br)c(F)cc32)CCCC1 |
| InChI | InChI=1S/C15H17BrClFN2/c1-15(4-2-3-5-15)9-20-13-7-11(18)10(16)6-12(13)19-14(20)8-17/h6-7H,2-5,8-9H2,1H3 |
| InChIKey | DRZTUXWGCPAWFO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|