C16H19Cl2FN2 — CID 66112399
5-chloro-2-(2-chloroethyl)-6-fluoro-1-[(1-methylcyclopentyl)methyl]benzimidazole (PubChem CID 66112399) has the molecular formula C16H19Cl2FN2 and a molecular weight of 329.25 g/mol. Its IUPAC name is 5-chloro-2-(2-chloroethyl)-6-fluoro-1-[(1-methylcyclopentyl)methyl]benzimidazole.
| Compound Name | 5-chloro-2-(2-chloroethyl)-6-fluoro-1-[(1-methylcyclopentyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 66112399 |
| Molecular Formula | C16H19Cl2FN2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 5-chloro-2-(2-chloroethyl)-6-fluoro-1-[(1-methylcyclopentyl)methyl]benzimidazole |
| SMILES | CC1(Cn2c(CCCl)nc3cc(Cl)c(F)cc32)CCCC1 |
| InChI | InChI=1S/C16H19Cl2FN2/c1-16(5-2-3-6-16)10-21-14-9-12(19)11(18)8-13(14)20-15(21)4-7-17/h8-9H,2-7,10H2,1H3 |
| InChIKey | AYLSQLIHJMMVKV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|