C12H13Cl2FN4O — CID 83115130
2-[5-chloro-2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethylurea (PubChem CID 83115130) has the molecular formula C12H13Cl2FN4O and a molecular weight of 319.17 g/mol. Its IUPAC name is 2-[5-chloro-2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethylurea.
| Compound Name | 2-[5-chloro-2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethylurea |
|---|---|
| PubChem CID | 83115130 |
| Molecular Formula | C12H13Cl2FN4O |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[5-chloro-2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethylurea |
| SMILES | NC(=O)NCCn1c(CCCl)nc2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C12H13Cl2FN4O/c13-2-1-11-18-9-5-7(14)8(15)6-10(9)19(11)4-3-17-12(16)20/h5-6H,1-4H2,(H3,16,17,20) |
| InChIKey | ZHDFIXPGUCJVPZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|