C11H12Cl2N4O — CID 83115048
2-[5-chloro-2-(chloromethyl)benzimidazol-1-yl]ethylurea (PubChem CID 83115048) has the molecular formula C11H12Cl2N4O and a molecular weight of 287.15 g/mol. Its IUPAC name is 2-[5-chloro-2-(chloromethyl)benzimidazol-1-yl]ethylurea.
| Compound Name | 2-[5-chloro-2-(chloromethyl)benzimidazol-1-yl]ethylurea |
|---|---|
| PubChem CID | 83115048 |
| Molecular Formula | C11H12Cl2N4O |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-[5-chloro-2-(chloromethyl)benzimidazol-1-yl]ethylurea |
| SMILES | NC(=O)NCCn1c(CCl)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H12Cl2N4O/c12-6-10-16-8-5-7(13)1-2-9(8)17(10)4-3-15-11(14)18/h1-2,5H,3-4,6H2,(H3,14,15,18) |
| InChIKey | SSYIZPXCHFPIFR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|