C13H16Cl2N4O — CID 83115200
3-[2-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-1,1-dimethylurea (PubChem CID 83115200) has the molecular formula C13H16Cl2N4O and a molecular weight of 315.20 g/mol. Its IUPAC name is 3-[2-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83115200 |
| Molecular Formula | C13H16Cl2N4O |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-[2-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCn1c(CCl)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H16Cl2N4O/c1-18(2)13(20)16-5-6-19-11-7-9(15)3-4-10(11)17-12(19)8-14/h3-4,7H,5-6,8H2,1-2H3,(H,16,20) |
| InChIKey | RAUCRALOUGTFNO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|