C14H18ClFN4O — CID 83112604
3-[2-[2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]-1,1-dimethylurea (PubChem CID 83112604) has the molecular formula C14H18ClFN4O and a molecular weight of 312.78 g/mol. Its IUPAC name is 3-[2-[2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83112604 |
| Molecular Formula | C14H18ClFN4O |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-[2-[2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCn1c(CCCl)nc2ccc(F)cc21 |
| InChI | InChI=1S/C14H18ClFN4O/c1-19(2)14(21)17-7-8-20-12-9-10(16)3-4-11(12)18-13(20)5-6-15/h3-4,9H,5-8H2,1-2H3,(H,17,21) |
| InChIKey | SKRJRKLUQYDDLM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|