C13H17ClFN3O2S — CID 106339159
N-[3-[2-(2-chloroethyl)-5-fluorobenzimidazol-1-yl]propyl]methanesulfonamide (PubChem CID 106339159) has the molecular formula C13H17ClFN3O2S and a molecular weight of 333.82 g/mol. Its IUPAC name is N-[3-[2-(2-chloroethyl)-5-fluorobenzimidazol-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[2-(2-chloroethyl)-5-fluorobenzimidazol-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106339159 |
| Molecular Formula | C13H17ClFN3O2S |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[3-[2-(2-chloroethyl)-5-fluorobenzimidazol-1-yl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1c(CCCl)nc2cc(F)ccc21 |
| InChI | InChI=1S/C13H17ClFN3O2S/c1-21(19,20)16-7-2-8-18-12-4-3-10(15)9-11(12)17-13(18)5-6-14/h3-4,9,16H,2,5-8H2,1H3 |
| InChIKey | HCQCOYNYZRPCLP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|