C14H18ClFN2O2S — CID 103593576
2-(2-chloroethyl)-5-fluoro-6-methyl-1-(3-methylsulfonylpropyl)benzimidazole (PubChem CID 103593576) has the molecular formula C14H18ClFN2O2S and a molecular weight of 332.83 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(3-methylsulfonylpropyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(3-methylsulfonylpropyl)benzimidazole |
|---|---|
| PubChem CID | 103593576 |
| Molecular Formula | C14H18ClFN2O2S |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(3-methylsulfonylpropyl)benzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(CCCl)n2CCCS(C)(=O)=O |
| InChI | InChI=1S/C14H18ClFN2O2S/c1-10-8-13-12(9-11(10)16)17-14(4-5-15)18(13)6-3-7-21(2,19)20/h8-9H,3-7H2,1-2H3 |
| InChIKey | NWBXYXBDLZCOSK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|