C16H16ClFN2O — CID 103593513
2-(2-chloroethyl)-5-fluoro-1-[2-(furan-2-yl)ethyl]-6-methylbenzimidazole (PubChem CID 103593513) has the molecular formula C16H16ClFN2O and a molecular weight of 306.77 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-fluoro-1-[2-(furan-2-yl)ethyl]-6-methylbenzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-fluoro-1-[2-(furan-2-yl)ethyl]-6-methylbenzimidazole |
|---|---|
| PubChem CID | 103593513 |
| Molecular Formula | C16H16ClFN2O |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(2-chloroethyl)-5-fluoro-1-[2-(furan-2-yl)ethyl]-6-methylbenzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(CCCl)n2CCc1ccco1 |
| InChI | InChI=1S/C16H16ClFN2O/c1-11-9-15-14(10-13(11)18)19-16(4-6-17)20(15)7-5-12-3-2-8-21-12/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | KJTOGTFVQRGMEF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|