C13H12ClFN4O — CID 106407005
3-[[2-(2-chloroethyl)-5-fluoro-6-methylbenzimidazol-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 106407005) has the molecular formula C13H12ClFN4O and a molecular weight of 294.72 g/mol. Its IUPAC name is 3-[[2-(2-chloroethyl)-5-fluoro-6-methylbenzimidazol-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[[2-(2-chloroethyl)-5-fluoro-6-methylbenzimidazol-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106407005 |
| Molecular Formula | C13H12ClFN4O |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[[2-(2-chloroethyl)-5-fluoro-6-methylbenzimidazol-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | Cc1cc2c(cc1F)nc(CCCl)n2Cc1ncon1 |
| InChI | InChI=1S/C13H12ClFN4O/c1-8-4-11-10(5-9(8)15)17-13(2-3-14)19(11)6-12-16-7-20-18-12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | CDLZAOLHNVQCQT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|