C14H18ClFN2S — CID 103593965
2-(2-chloroethyl)-5-fluoro-6-methyl-1-(2-methylsulfanylpropyl)benzimidazole (PubChem CID 103593965) has the molecular formula C14H18ClFN2S and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(2-methylsulfanylpropyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(2-methylsulfanylpropyl)benzimidazole |
|---|---|
| PubChem CID | 103593965 |
| Molecular Formula | C14H18ClFN2S |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(2-methylsulfanylpropyl)benzimidazole |
| SMILES | CSC(C)Cn1c(CCCl)nc2cc(F)c(C)cc21 |
| InChI | InChI=1S/C14H18ClFN2S/c1-9-6-13-12(7-11(9)16)17-14(4-5-15)18(13)8-10(2)19-3/h6-7,10H,4-5,8H2,1-3H3 |
| InChIKey | SISDZZQRFLSJRV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|