C12H16FN3S — CID 103593126
5-fluoro-6-methyl-1-(2-methylsulfanylpropyl)benzimidazol-2-amine (PubChem CID 103593126) has the molecular formula C12H16FN3S and a molecular weight of 253.35 g/mol. Its IUPAC name is 5-fluoro-6-methyl-1-(2-methylsulfanylpropyl)benzimidazol-2-amine.
| Compound Name | 5-fluoro-6-methyl-1-(2-methylsulfanylpropyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 103593126 |
| Molecular Formula | C12H16FN3S |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-fluoro-6-methyl-1-(2-methylsulfanylpropyl)benzimidazol-2-amine |
| SMILES | CSC(C)Cn1c(N)nc2cc(F)c(C)cc21 |
| InChI | InChI=1S/C12H16FN3S/c1-7-4-11-10(5-9(7)13)15-12(14)16(11)6-8(2)17-3/h4-5,8H,6H2,1-3H3,(H2,14,15) |
| InChIKey | RKTSCUMMQJGPQU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |