C12H16FN3OS — CID 103593147
1-(2-ethylsulfinylethyl)-5-fluoro-6-methylbenzimidazol-2-amine (PubChem CID 103593147) has the molecular formula C12H16FN3OS and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(2-ethylsulfinylethyl)-5-fluoro-6-methylbenzimidazol-2-amine.
| Compound Name | 1-(2-ethylsulfinylethyl)-5-fluoro-6-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 103593147 |
| Molecular Formula | C12H16FN3OS |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-(2-ethylsulfinylethyl)-5-fluoro-6-methylbenzimidazol-2-amine |
| SMILES | CCS(=O)CCn1c(N)nc2cc(F)c(C)cc21 |
| InChI | InChI=1S/C12H16FN3OS/c1-3-18(17)5-4-16-11-6-8(2)9(13)7-10(11)15-12(16)14/h6-7H,3-5H2,1-2H3,(H2,14,15) |
| InChIKey | LREYSNRDBAKNJO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |