C12H14ClFN2OS — CID 103593989
2-(chloromethyl)-5-fluoro-6-methyl-1-(2-methylsulfinylethyl)benzimidazole (PubChem CID 103593989) has the molecular formula C12H14ClFN2OS and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-(chloromethyl)-5-fluoro-6-methyl-1-(2-methylsulfinylethyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-5-fluoro-6-methyl-1-(2-methylsulfinylethyl)benzimidazole |
|---|---|
| PubChem CID | 103593989 |
| Molecular Formula | C12H14ClFN2OS |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-(chloromethyl)-5-fluoro-6-methyl-1-(2-methylsulfinylethyl)benzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(CCl)n2CCS(C)=O |
| InChI | InChI=1S/C12H14ClFN2OS/c1-8-5-11-10(6-9(8)14)15-12(7-13)16(11)3-4-18(2)17/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | RVSWFFJMTKZYMZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|