C15H21ClFN3 — CID 103593564
1-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]-N,N,2-trimethylpropan-2-amine (PubChem CID 103593564) has the molecular formula C15H21ClFN3 and a molecular weight of 297.81 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]-N,N,2-trimethylpropan-2-amine.
| Compound Name | 1-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]-N,N,2-trimethylpropan-2-amine |
|---|---|
| PubChem CID | 103593564 |
| Molecular Formula | C15H21ClFN3 |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]-N,N,2-trimethylpropan-2-amine |
| SMILES | Cc1cc2c(cc1F)nc(CCl)n2CC(C)(C)N(C)C |
| InChI | InChI=1S/C15H21ClFN3/c1-10-6-13-12(7-11(10)17)18-14(8-16)20(13)9-15(2,3)19(4)5/h6-7H,8-9H2,1-5H3 |
| InChIKey | DHHUCMBQPSSVQA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|