C14H14ClFN4 — CID 103593623
2-(chloromethyl)-5-fluoro-6-methyl-1-[(1-methylpyrazol-4-yl)methyl]benzimidazole (PubChem CID 103593623) has the molecular formula C14H14ClFN4 and a molecular weight of 292.75 g/mol. Its IUPAC name is 2-(chloromethyl)-5-fluoro-6-methyl-1-[(1-methylpyrazol-4-yl)methyl]benzimidazole.
| Compound Name | 2-(chloromethyl)-5-fluoro-6-methyl-1-[(1-methylpyrazol-4-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 103593623 |
| Molecular Formula | C14H14ClFN4 |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-(chloromethyl)-5-fluoro-6-methyl-1-[(1-methylpyrazol-4-yl)methyl]benzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(CCl)n2Cc1cnn(C)c1 |
| InChI | InChI=1S/C14H14ClFN4/c1-9-3-13-12(4-11(9)16)18-14(5-15)20(13)8-10-6-17-19(2)7-10/h3-4,6-7H,5,8H2,1-2H3 |
| InChIKey | TUNMAORBZSOMTH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|