C13H12Cl2N4 — CID 113459143
4-chloro-2-(chloromethyl)-1-[(1-methylpyrazol-4-yl)methyl]benzimidazole (PubChem CID 113459143) has the molecular formula C13H12Cl2N4 and a molecular weight of 295.17 g/mol. Its IUPAC name is 4-chloro-2-(chloromethyl)-1-[(1-methylpyrazol-4-yl)methyl]benzimidazole.
| Compound Name | 4-chloro-2-(chloromethyl)-1-[(1-methylpyrazol-4-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 113459143 |
| Molecular Formula | C13H12Cl2N4 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 4-chloro-2-(chloromethyl)-1-[(1-methylpyrazol-4-yl)methyl]benzimidazole |
| SMILES | Cn1cc(Cn2c(CCl)nc3c(Cl)cccc32)cn1 |
| InChI | InChI=1S/C13H12Cl2N4/c1-18-7-9(6-16-18)8-19-11-4-2-3-10(15)13(11)17-12(19)5-14/h2-4,6-7H,5,8H2,1H3 |
| InChIKey | UCRZAHHRDVUFGY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|