C12H15ClN6 — CID 79287958
5-(chloromethyl)-1,3-dimethyl-6-[(1-methylpyrazol-4-yl)methyl]imidazo[4,5-d]pyrazole (PubChem CID 79287958) has the molecular formula C12H15ClN6 and a molecular weight of 278.75 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethyl-6-[(1-methylpyrazol-4-yl)methyl]imidazo[4,5-d]pyrazole.
| Compound Name | 5-(chloromethyl)-1,3-dimethyl-6-[(1-methylpyrazol-4-yl)methyl]imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79287958 |
| Molecular Formula | C12H15ClN6 |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethyl-6-[(1-methylpyrazol-4-yl)methyl]imidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2Cc1cnn(C)c1 |
| InChI | InChI=1S/C12H15ClN6/c1-8-11-12(18(3)16-8)19(10(4-13)15-11)7-9-5-14-17(2)6-9/h5-6H,4,7H2,1-3H3 |
| InChIKey | YMGCURCZQXIXMQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|