C14H19ClN6 — CID 79282236
5-(2-chloroethyl)-3-ethyl-1-methyl-6-[(1-methylpyrazol-4-yl)methyl]imidazo[4,5-d]pyrazole (PubChem CID 79282236) has the molecular formula C14H19ClN6 and a molecular weight of 306.80 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-ethyl-1-methyl-6-[(1-methylpyrazol-4-yl)methyl]imidazo[4,5-d]pyrazole.
| Compound Name | 5-(2-chloroethyl)-3-ethyl-1-methyl-6-[(1-methylpyrazol-4-yl)methyl]imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79282236 |
| Molecular Formula | C14H19ClN6 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 5-(2-chloroethyl)-3-ethyl-1-methyl-6-[(1-methylpyrazol-4-yl)methyl]imidazo[4,5-d]pyrazole |
| SMILES | CCc1nn(C)c2c1nc(CCCl)n2Cc1cnn(C)c1 |
| InChI | InChI=1S/C14H19ClN6/c1-4-11-13-14(20(3)18-11)21(12(17-13)5-6-15)9-10-7-16-19(2)8-10/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | MKVSDAAKKMAVDH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|