C15H15ClFN3S — CID 103593695
2-[2-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]ethyl]-4-methyl-1,3-thiazole (PubChem CID 103593695) has the molecular formula C15H15ClFN3S and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-[2-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]ethyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[2-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]ethyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 103593695 |
| Molecular Formula | C15H15ClFN3S |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-[2-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]ethyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(CCn2c(CCl)nc3cc(F)c(C)cc32)n1 |
| InChI | InChI=1S/C15H15ClFN3S/c1-9-5-13-12(6-11(9)17)19-14(7-16)20(13)4-3-15-18-10(2)8-21-15/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | MUTTWSOWJIXAKI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|