C15H19ClFN3O — CID 103593940
2-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]-N,N-diethylacetamide (PubChem CID 103593940) has the molecular formula C15H19ClFN3O and a molecular weight of 311.79 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 103593940 |
| Molecular Formula | C15H19ClFN3O |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[2-(chloromethyl)-5-fluoro-6-methylbenzimidazol-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1c(CCl)nc2cc(F)c(C)cc21 |
| InChI | InChI=1S/C15H19ClFN3O/c1-4-19(5-2)15(21)9-20-13-6-10(3)11(17)7-12(13)18-14(20)8-16/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | NCZJWQFOPYIPBV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|