C12H13ClIN3O — CID 66082419
2-[2-(chloromethyl)-5-iodobenzimidazol-1-yl]-N,N-dimethylacetamide (PubChem CID 66082419) has the molecular formula C12H13ClIN3O and a molecular weight of 377.61 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-5-iodobenzimidazol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[2-(chloromethyl)-5-iodobenzimidazol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 66082419 |
| Molecular Formula | C12H13ClIN3O |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 2-[2-(chloromethyl)-5-iodobenzimidazol-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1c(CCl)nc2cc(I)ccc21 |
| InChI | InChI=1S/C12H13ClIN3O/c1-16(2)12(18)7-17-10-4-3-8(14)5-9(10)15-11(17)6-13/h3-5H,6-7H2,1-2H3 |
| InChIKey | IXBPOBISJAEEII-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|