C11H12BrClN4O — CID 79302530
2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylacetamide (PubChem CID 79302530) has the molecular formula C11H12BrClN4O and a molecular weight of 331.60 g/mol. Its IUPAC name is 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 79302530 |
| Molecular Formula | C11H12BrClN4O |
| Molecular Weight | 331.60 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1c(CCl)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C11H12BrClN4O/c1-16(2)10(18)6-17-9(4-13)15-8-3-7(12)5-14-11(8)17/h3,5H,4,6H2,1-2H3 |
| InChIKey | BVQAZSMMJSMSKE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|