C12H13BrClN3O2 — CID 79302535
ethyl 2-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]acetate (PubChem CID 79302535) has the molecular formula C12H13BrClN3O2 and a molecular weight of 346.61 g/mol. Its IUPAC name is ethyl 2-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]acetate.
| Compound Name | ethyl 2-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 79302535 |
| Molecular Formula | C12H13BrClN3O2 |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | ethyl 2-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]acetate |
| SMILES | CCOC(=O)Cn1c(CCCl)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C12H13BrClN3O2/c1-2-19-11(18)7-17-10(3-4-14)16-9-5-8(13)6-15-12(9)17/h5-6H,2-4,7H2,1H3 |
| InChIKey | HHURNSUXEYMOJP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|