C13H17BrClN3O — CID 79302095
6-bromo-2-(2-chloroethyl)-3-(3-ethoxypropyl)imidazo[4,5-b]pyridine (PubChem CID 79302095) has the molecular formula C13H17BrClN3O and a molecular weight of 346.66 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-3-(3-ethoxypropyl)imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(2-chloroethyl)-3-(3-ethoxypropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79302095 |
| Molecular Formula | C13H17BrClN3O |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-3-(3-ethoxypropyl)imidazo[4,5-b]pyridine |
| SMILES | CCOCCCn1c(CCCl)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C13H17BrClN3O/c1-2-19-7-3-6-18-12(4-5-15)17-11-8-10(14)9-16-13(11)18/h8-9H,2-7H2,1H3 |
| InChIKey | NLNHMBQVVJZQTI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|