C13H12BrClN4S — CID 79302623
4-[2-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-1,3-thiazole (PubChem CID 79302623) has the molecular formula C13H12BrClN4S and a molecular weight of 371.69 g/mol. Its IUPAC name is 4-[2-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-1,3-thiazole.
| Compound Name | 4-[2-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79302623 |
| Molecular Formula | C13H12BrClN4S |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 4-[2-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-1,3-thiazole |
| SMILES | ClCCc1nc2cc(Br)cnc2n1CCc1cscn1 |
| InChI | InChI=1S/C13H12BrClN4S/c14-9-5-11-13(16-6-9)19(12(18-11)1-3-15)4-2-10-7-20-8-17-10/h5-8H,1-4H2 |
| InChIKey | MMCLNDKXRJRNRB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|