C14H15BrClN5 — CID 103008938
6-bromo-2-(2-chloroethyl)-3-[2-(2-methylpyrazol-3-yl)ethyl]imidazo[4,5-b]pyridine (PubChem CID 103008938) has the molecular formula C14H15BrClN5 and a molecular weight of 368.67 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-3-[2-(2-methylpyrazol-3-yl)ethyl]imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(2-chloroethyl)-3-[2-(2-methylpyrazol-3-yl)ethyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 103008938 |
| Molecular Formula | C14H15BrClN5 |
| Molecular Weight | 368.67 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-3-[2-(2-methylpyrazol-3-yl)ethyl]imidazo[4,5-b]pyridine |
| SMILES | Cn1nccc1CCn1c(CCCl)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C14H15BrClN5/c1-20-11(3-6-18-20)4-7-21-13(2-5-16)19-12-8-10(15)9-17-14(12)21/h3,6,8-9H,2,4-5,7H2,1H3 |
| InChIKey | FLNZVUNBVHVCAR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|