C13H13BrClN5 — CID 79301903
6-bromo-2-(2-chloroethyl)-3-(2-imidazol-1-ylethyl)imidazo[4,5-b]pyridine (PubChem CID 79301903) has the molecular formula C13H13BrClN5 and a molecular weight of 354.64 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-3-(2-imidazol-1-ylethyl)imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(2-chloroethyl)-3-(2-imidazol-1-ylethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79301903 |
| Molecular Formula | C13H13BrClN5 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-3-(2-imidazol-1-ylethyl)imidazo[4,5-b]pyridine |
| SMILES | ClCCc1nc2cc(Br)cnc2n1CCn1ccnc1 |
| InChI | InChI=1S/C13H13BrClN5/c14-10-7-11-13(17-8-10)20(12(18-11)1-2-15)6-5-19-4-3-16-9-19/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | XNIPOMUPDABPHF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|