C15H22BrClN4 — CID 79280592
3-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylpropan-1-amine (PubChem CID 79280592) has the molecular formula C15H22BrClN4 and a molecular weight of 373.73 g/mol. Its IUPAC name is 3-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 79280592 |
| Molecular Formula | C15H22BrClN4 |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 3-[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCn1c(CCCl)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C15H22BrClN4/c1-3-20(4-2)8-5-9-21-14(6-7-17)19-13-10-12(16)11-18-15(13)21/h10-11H,3-9H2,1-2H3 |
| InChIKey | DYAAHMYWYRQOBA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|