C13H14BrClN6 — CID 106303086
6-bromo-2-(2-chloroethyl)-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazo[4,5-b]pyridine (PubChem CID 106303086) has the molecular formula C13H14BrClN6 and a molecular weight of 369.65 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(2-chloroethyl)-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 106303086 |
| Molecular Formula | C13H14BrClN6 |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazo[4,5-b]pyridine |
| SMILES | CCn1cnnc1Cn1c(CCCl)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C13H14BrClN6/c1-2-20-8-17-19-12(20)7-21-11(3-4-15)18-10-5-9(14)6-16-13(10)21/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | JZLLAQHUBOMUCJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|