C14H16ClN5 — CID 106302994
2-(2-chloroethyl)-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]benzimidazole (PubChem CID 106302994) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]benzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 106302994 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-(2-chloroethyl)-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]benzimidazole |
| SMILES | CCn1cnnc1Cn1c(CCCl)nc2ccccc21 |
| InChI | InChI=1S/C14H16ClN5/c1-2-19-10-16-18-14(19)9-20-12-6-4-3-5-11(12)17-13(20)7-8-15/h3-6,10H,2,7-9H2,1H3 |
| InChIKey | KAKZEQVIRGCJBC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|