C13H13Cl2N5 — CID 62117938
5-chloro-2-(2-chloroethyl)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole (PubChem CID 62117938) has the molecular formula C13H13Cl2N5 and a molecular weight of 310.19 g/mol. Its IUPAC name is 5-chloro-2-(2-chloroethyl)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole.
| Compound Name | 5-chloro-2-(2-chloroethyl)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 62117938 |
| Molecular Formula | C13H13Cl2N5 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 5-chloro-2-(2-chloroethyl)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole |
| SMILES | Cn1cnnc1Cn1c(CCCl)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H13Cl2N5/c1-19-8-16-18-13(19)7-20-11-3-2-9(15)6-10(11)17-12(20)4-5-14/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | MZPYQSADJDYOND-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|