C14H14Cl2N4 — CID 63302249
5-chloro-2-(2-chloroethyl)-1-[(2-methylpyrazol-3-yl)methyl]benzimidazole (PubChem CID 63302249) has the molecular formula C14H14Cl2N4 and a molecular weight of 309.20 g/mol. Its IUPAC name is 5-chloro-2-(2-chloroethyl)-1-[(2-methylpyrazol-3-yl)methyl]benzimidazole.
| Compound Name | 5-chloro-2-(2-chloroethyl)-1-[(2-methylpyrazol-3-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 63302249 |
| Molecular Formula | C14H14Cl2N4 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-chloro-2-(2-chloroethyl)-1-[(2-methylpyrazol-3-yl)methyl]benzimidazole |
| SMILES | Cn1nccc1Cn1c(CCCl)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H14Cl2N4/c1-19-11(5-7-17-19)9-20-13-3-2-10(16)8-12(13)18-14(20)4-6-15/h2-3,5,7-8H,4,6,9H2,1H3 |
| InChIKey | YHFXHOKWKFCESX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|