C16H15Cl2N3 — CID 60902566
5-chloro-2-(2-chloroethyl)-1-(2-pyridin-4-ylethyl)benzimidazole (PubChem CID 60902566) has the molecular formula C16H15Cl2N3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 5-chloro-2-(2-chloroethyl)-1-(2-pyridin-4-ylethyl)benzimidazole.
| Compound Name | 5-chloro-2-(2-chloroethyl)-1-(2-pyridin-4-ylethyl)benzimidazole |
|---|---|
| PubChem CID | 60902566 |
| Molecular Formula | C16H15Cl2N3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 5-chloro-2-(2-chloroethyl)-1-(2-pyridin-4-ylethyl)benzimidazole |
| SMILES | ClCCc1nc2cc(Cl)ccc2n1CCc1ccncc1 |
| InChI | InChI=1S/C16H15Cl2N3/c17-7-3-16-20-14-11-13(18)1-2-15(14)21(16)10-6-12-4-8-19-9-5-12/h1-2,4-5,8-9,11H,3,6-7,10H2 |
| InChIKey | FHTTXWIMVICYKM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|