C12H11BrClN5 — CID 62117759
5-bromo-2-(chloromethyl)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole (PubChem CID 62117759) has the molecular formula C12H11BrClN5 and a molecular weight of 340.61 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole.
| Compound Name | 5-bromo-2-(chloromethyl)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 62117759 |
| Molecular Formula | C12H11BrClN5 |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole |
| SMILES | Cn1cnnc1Cn1c(CCl)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H11BrClN5/c1-18-7-15-17-12(18)6-19-10-3-2-8(13)4-9(10)16-11(19)5-14/h2-4,7H,5-6H2,1H3 |
| InChIKey | XPKIINXKSLQNHG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|